C19H23BrN2O2 — CID 119519137
1-[4-(1-aminoethyl)piperidin-1-yl]-2-(6-bromonaphthalen-2-yl)oxyethanone (PubChem CID 119519137) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(6-bromonaphthalen-2-yl)oxyethanone.
| Compound Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(6-bromonaphthalen-2-yl)oxyethanone |
|---|---|
| PubChem CID | 119519137 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-2-(6-bromonaphthalen-2-yl)oxyethanone |
| SMILES | CC(N)C1CCN(C(=O)COc2ccc3cc(Br)ccc3c2)CC1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-13(21)14-6-8-22(9-7-14)19(23)12-24-18-5-3-15-10-17(20)4-2-16(15)11-18/h2-5,10-11,13-14H,6-9,12,21H2,1H3 |
| InChIKey | HWDFAHSJXNEUQL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |