C14H9N5O — CID 11952560
6-(furan-2-yl)-5-pyrimidin-4-yl-1H-pyrazolo[3,4-b]pyridine (PubChem CID 11952560) has the molecular formula C14H9N5O and a molecular weight of 263.26 g/mol. Its IUPAC name is 6-(furan-2-yl)-5-pyrimidin-4-yl-1H-pyrazolo[3,4-b]pyridine.
| Compound Name | 6-(furan-2-yl)-5-pyrimidin-4-yl-1H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 11952560 |
| Molecular Formula | C14H9N5O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 6-(furan-2-yl)-5-pyrimidin-4-yl-1H-pyrazolo[3,4-b]pyridine |
| SMILES | c1coc(-c2nc3[nH]ncc3cc2-c2ccncn2)c1 |
| InChI | InChI=1S/C14H9N5O/c1-2-12(20-5-1)13-10(11-3-4-15-8-16-11)6-9-7-17-19-14(9)18-13/h1-8H,(H,17,18,19) |
| InChIKey | FUZVDFCUPYVIEA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |