C20H32N4O2 — CID 119526973
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(cyclohexylcarbamoylamino)acetamide (PubChem CID 119526973) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(cyclohexylcarbamoylamino)acetamide.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(cyclohexylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 119526973 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(cyclohexylcarbamoylamino)acetamide |
| SMILES | CC(C)c1ccc(C(N)CNC(=O)CNC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H32N4O2/c1-14(2)15-8-10-16(11-9-15)18(21)12-22-19(25)13-23-20(26)24-17-6-4-3-5-7-17/h8-11,14,17-18H,3-7,12-13,21H2,1-2H3,(H,22,25)(H2,23,24,26) |
| InChIKey | XMTSOIUPDPXJLI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |