C18H25N3O4 — CID 119254873
3-[[2-(cyclohexylcarbamoylamino)acetyl]amino]-2-phenylpropanoic acid (PubChem CID 119254873) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[[2-(cyclohexylcarbamoylamino)acetyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[2-(cyclohexylcarbamoylamino)acetyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 119254873 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-[[2-(cyclohexylcarbamoylamino)acetyl]amino]-2-phenylpropanoic acid |
| SMILES | O=C(CNC(=O)NC1CCCCC1)NCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O4/c22-16(12-20-18(25)21-14-9-5-2-6-10-14)19-11-15(17(23)24)13-7-3-1-4-8-13/h1,3-4,7-8,14-15H,2,5-6,9-12H2,(H,19,22)(H,23,24)(H2,20,21,25) |
| InChIKey | ZHWHDRNLIUTVOG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |