C21H25ClN4O3 — CID 119527688
N-(2-amino-2-phenylethyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride (PubChem CID 119527688) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119527688 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)NCC(N)c3ccccc3)C2=O)cc1.Cl |
| InChI | InChI=1S/C21H24N4O3.ClH/c1-14-8-10-16(11-9-14)21(2)19(27)25(20(28)24-21)13-18(26)23-12-17(22)15-6-4-3-5-7-15;/h3-11,17H,12-13,22H2,1-2H3,(H,23,26)(H,24,28);1H |
| InChIKey | WYARGYMDBOSGJM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|