C19H21NO7 — CID 11953309
tert-butyl (4S,7R,8R)-8-benzoyloxy-7-methyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octane-5-carboxylate (PubChem CID 11953309) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is tert-butyl (4S,7R,8R)-8-benzoyloxy-7-methyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octane-5-carboxylate.
| Compound Name | tert-butyl (4S,7R,8R)-8-benzoyloxy-7-methyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
|---|---|
| PubChem CID | 11953309 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | tert-butyl (4S,7R,8R)-8-benzoyloxy-7-methyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octane-5-carboxylate |
| SMILES | C[C@H]1C(=O)N(C(=O)OC(C)(C)C)[C@@]2(COC2=O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO7/c1-11-13(26-15(22)12-8-6-5-7-9-12)19(10-25-16(19)23)20(14(11)21)17(24)27-18(2,3)4/h5-9,11,13H,10H2,1-4H3/t11-,13-,19+/m1/s1 |
| InChIKey | LOHQWBSNHKUGGU-MVBJNABHSA-N |
| XLogP | 1.92 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|