About 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide
2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide (PubChem CID 119533243) has the molecular formula C20H30ClN3O2
and a molecular weight of 379.93 g/mol. Its IUPAC name is 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide |
| PubChem CID | 119533243 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide |
| SMILES | CCCN(C(=O)c1cc(NC(=O)CC(C)(C)C)ccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C20H30ClN3O2/c1-5-10-24(15-8-9-22-13-15)19(26)16-11-14(6-7-17(16)21)23-18(25)12-20(2,3)4/h6-7,11,15,22H,5,8-10,12-13H2,1-4H3,(H,23,25) |
| InChIKey | CXFXICQOEXFSFT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide?
The IUPAC name of 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide (CID 119533243) is 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide.
What is the SMILES notation for 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide?
The canonical SMILES for 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide is CCCN(C(=O)c1cc(NC(=O)CC(C)(C)C)ccc1Cl)C1CCNC1.
What is the InChIKey of 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide?
The InChIKey is CXFXICQOEXFSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30ClN3O2/c1-5-10-24(15-8-9-22-13-15)19(26)16-11-14(6-7-17(16)21)23-18(25)12-20(2,3)4/h6-7,11,15,22H,5,8-10,12-13H2,1-4H3,(H,23,25).
What are the key properties of 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide?
2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide has a molecular weight of 379.93 g/mol, XLogP of 3.93, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3,3-dimethylbutanoylamino)-N-propyl-N-pyrrolidin-3-ylbenzamide is sourced from PubChem (CID 119533243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).