C10H22N2O2 — CID 11953520
4,4-diethoxy-1-methylpiperidin-3-amine (PubChem CID 11953520) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4,4-diethoxy-1-methylpiperidin-3-amine.
| Compound Name | 4,4-diethoxy-1-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 11953520 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4,4-diethoxy-1-methylpiperidin-3-amine |
| SMILES | CCOC1(OCC)CCN(C)CC1N |
| InChI | InChI=1S/C10H22N2O2/c1-4-13-10(14-5-2)6-7-12(3)8-9(10)11/h9H,4-8,11H2,1-3H3 |
| InChIKey | YNCRMJAIJFENAI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|