C18H22BrClN2O3 — CID 119537396
5-[(3-bromophenoxy)methyl]-N-(2-pyrrolidin-3-ylethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119537396) has the molecular formula C18H22BrClN2O3 and a molecular weight of 429.74 g/mol. Its IUPAC name is 5-[(3-bromophenoxy)methyl]-N-(2-pyrrolidin-3-ylethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | 5-[(3-bromophenoxy)methyl]-N-(2-pyrrolidin-3-ylethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119537396 |
| Molecular Formula | C18H22BrClN2O3 |
| Molecular Weight | 429.74 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 5-[(3-bromophenoxy)methyl]-N-(2-pyrrolidin-3-ylethyl)furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCNC1)c1ccc(COc2cccc(Br)c2)o1 |
| InChI | InChI=1S/C18H21BrN2O3.ClH/c19-14-2-1-3-15(10-14)23-12-16-4-5-17(24-16)18(22)21-9-7-13-6-8-20-11-13;/h1-5,10,13,20H,6-9,11-12H2,(H,21,22);1H |
| InChIKey | BTJQDLZFHQWECP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |