C18H21BrN2O3 — CID 119563369
[5-[(3-bromophenoxy)methyl]furan-2-yl]-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119563369) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is [5-[(3-bromophenoxy)methyl]furan-2-yl]-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | [5-[(3-bromophenoxy)methyl]furan-2-yl]-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119563369 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [5-[(3-bromophenoxy)methyl]furan-2-yl]-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCN(C(=O)c2ccc(COc3cccc(Br)c3)o2)CC1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-20-14-7-9-21(10-8-14)18(22)17-6-5-16(24-17)12-23-15-4-2-3-13(19)11-15/h2-6,11,14,20H,7-10,12H2,1H3 |
| InChIKey | AQAWXXRVEOMEPT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |