C21H22BrN3O5 — CID 46489072
5-[(3-bromophenoxy)methyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)furan-2-carboxamide (PubChem CID 46489072) has the molecular formula C21H22BrN3O5 and a molecular weight of 476.33 g/mol. Its IUPAC name is 5-[(3-bromophenoxy)methyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(3-bromophenoxy)methyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46489072 |
| Molecular Formula | C21H22BrN3O5 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 5-[(3-bromophenoxy)methyl]-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)furan-2-carboxamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)c1ccc(COc3cccc(Br)c3)o1)C2=O |
| InChI | InChI=1S/C21H22BrN3O5/c1-13-7-9-21(10-8-13)19(27)25(20(28)23-21)24-18(26)17-6-5-16(30-17)12-29-15-4-2-3-14(22)11-15/h2-6,11,13H,7-10,12H2,1H3,(H,23,28)(H,24,26) |
| InChIKey | BQQHVXJQZZDSGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|