C19H20BrN3O4 — CID 16573952
5-bromo-3-methyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide (PubChem CID 16573952) has the molecular formula C19H20BrN3O4 and a molecular weight of 434.29 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16573952 |
| Molecular Formula | C19H20BrN3O4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 5-bromo-3-methyl-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NN2C(=O)NC3(CCC(C)CC3)C2=O)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C19H20BrN3O4/c1-10-5-7-19(8-6-10)17(25)23(18(26)21-19)22-16(24)15-11(2)13-9-12(20)3-4-14(13)27-15/h3-4,9-10H,5-8H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | DGTYDUILWKGIIE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|