C17H16BrN3O4 — CID 46429890
5-bromo-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide (PubChem CID 46429890) has the molecular formula C17H16BrN3O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 46429890 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 5-bromo-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NN1C(=O)NC2(CCCCC2)C1=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C17H16BrN3O4/c18-11-4-5-12-10(8-11)9-13(25-12)14(22)20-21-15(23)17(19-16(21)24)6-2-1-3-7-17/h4-5,8-9H,1-3,6-7H2,(H,19,24)(H,20,22) |
| InChIKey | XGSXBGNLKCKGOK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|