C22H29BrN2O2 — CID 3950385
5-bromo-3-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 3950385) has the molecular formula C22H29BrN2O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3950385 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-bromo-3-methyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCC2(N3CCCCC3)CCCCC2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C22H29BrN2O2/c1-16-18-14-17(23)8-9-19(18)27-20(16)21(26)24-15-22(10-4-2-5-11-22)25-12-6-3-7-13-25/h8-9,14H,2-7,10-13,15H2,1H3,(H,24,26) |
| InChIKey | KJCRYSQKWSFPBG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |