C16H20BrClN2O2 — CID 120602547
5-bromo-3-methyl-N-(2-methylpiperidin-4-yl)-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 120602547) has the molecular formula C16H20BrClN2O2 and a molecular weight of 387.71 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(2-methylpiperidin-4-yl)-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | 5-bromo-3-methyl-N-(2-methylpiperidin-4-yl)-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120602547 |
| Molecular Formula | C16H20BrClN2O2 |
| Molecular Weight | 387.71 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 5-bromo-3-methyl-N-(2-methylpiperidin-4-yl)-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC2CCNC(C)C2)oc2ccc(Br)cc12.Cl |
| InChI | InChI=1S/C16H19BrN2O2.ClH/c1-9-7-12(5-6-18-9)19-16(20)15-10(2)13-8-11(17)3-4-14(13)21-15;/h3-4,8-9,12,18H,5-7H2,1-2H3,(H,19,20);1H |
| InChIKey | NWWHZZHMLUESQE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |