C22H25ClN2O3 — CID 120602574
N-(2-methylpiperidin-4-yl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide;hydrochloride (PubChem CID 120602574) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-4-yl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120602574 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-3-(phenoxymethyl)-1-benzofuran-2-carboxamide;hydrochloride |
| SMILES | CC1CC(NC(=O)c2oc3ccccc3c2COc2ccccc2)CCN1.Cl |
| InChI | InChI=1S/C22H24N2O3.ClH/c1-15-13-16(11-12-23-15)24-22(25)21-19(14-26-17-7-3-2-4-8-17)18-9-5-6-10-20(18)27-21;/h2-10,15-16,23H,11-14H2,1H3,(H,24,25);1H |
| InChIKey | YJMQEFNUSQVARS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |