C22H25BrN2O4 — CID 55773113
[1-[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 55773113) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is [1-[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 55773113 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [1-[5-[(3-bromophenoxy)methyl]furan-2-carbonyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(COc2cccc(Br)c2)o1)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H25BrN2O4/c23-17-4-3-5-18(14-17)28-15-19-6-7-20(29-19)22(27)25-12-8-16(9-13-25)21(26)24-10-1-2-11-24/h3-7,14,16H,1-2,8-13,15H2 |
| InChIKey | FSECWXFEVSDPTA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |