C11H16Cl2N2OS — CID 119542062
(5-chlorothiophen-2-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119542062) has the molecular formula C11H16Cl2N2OS and a molecular weight of 295.23 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (5-chlorothiophen-2-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119542062 |
| Molecular Formula | C11H16Cl2N2OS |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[3-(methylaminomethyl)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2ccc(Cl)s2)C1.Cl |
| InChI | InChI=1S/C11H15ClN2OS.ClH/c1-13-6-8-4-5-14(7-8)11(15)9-2-3-10(12)16-9;/h2-3,8,13H,4-7H2,1H3;1H |
| InChIKey | WPYVQYNVVYXUJL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |