C14H19ClN2O2S — CID 91953871
1-(5-chlorothiophene-2-carbonyl)-N-propan-2-ylpiperidine-3-carboxamide (PubChem CID 91953871) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 1-(5-chlorothiophene-2-carbonyl)-N-propan-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-(5-chlorothiophene-2-carbonyl)-N-propan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 91953871 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(5-chlorothiophene-2-carbonyl)-N-propan-2-ylpiperidine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1CCCN(C(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-9(2)16-13(18)10-4-3-7-17(8-10)14(19)11-5-6-12(15)20-11/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | OMGVUKXUQCLFKH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |