C19H24ClN5O4 — CID 119543312
6-methyl-3-[4-(methylaminomethyl)piperidine-1-carbonyl]-1-(2-nitrophenyl)pyridazin-4-one;hydrochloride (PubChem CID 119543312) has the molecular formula C19H24ClN5O4 and a molecular weight of 421.89 g/mol. Its IUPAC name is 6-methyl-3-[4-(methylaminomethyl)piperidine-1-carbonyl]-1-(2-nitrophenyl)pyridazin-4-one;hydrochloride.
| Compound Name | 6-methyl-3-[4-(methylaminomethyl)piperidine-1-carbonyl]-1-(2-nitrophenyl)pyridazin-4-one;hydrochloride |
|---|---|
| PubChem CID | 119543312 |
| Molecular Formula | C19H24ClN5O4 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 6-methyl-3-[4-(methylaminomethyl)piperidine-1-carbonyl]-1-(2-nitrophenyl)pyridazin-4-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)c2nn(-c3ccccc3[N+](=O)[O-])c(C)cc2=O)CC1.Cl |
| InChI | InChI=1S/C19H23N5O4.ClH/c1-13-11-17(25)18(19(26)22-9-7-14(8-10-22)12-20-2)21-23(13)15-5-3-4-6-16(15)24(27)28;/h3-6,11,14,20H,7-10,12H2,1-2H3;1H |
| InChIKey | VJELTVCXYWUJPG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|