C19H21N5O6 — CID 51132446
methyl 4-[6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carbonyl]-1,4-diazepane-1-carboxylate (PubChem CID 51132446) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is methyl 4-[6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carbonyl]-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carbonyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 51132446 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 4-[6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carbonyl]-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(C(=O)c2nn(-c3ccccc3[N+](=O)[O-])c(C)cc2=O)CC1 |
| InChI | InChI=1S/C19H21N5O6/c1-13-12-16(25)17(20-23(13)14-6-3-4-7-15(14)24(28)29)18(26)21-8-5-9-22(11-10-21)19(27)30-2/h3-4,6-7,12H,5,8-11H2,1-2H3 |
| InChIKey | FXYXUYMMJIAHMR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 127.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|