C16H25ClN4O5S — CID 119543466
N-[3-[4-(methylaminomethyl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119543466) has the molecular formula C16H25ClN4O5S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[3-[4-(methylaminomethyl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-[4-(methylaminomethyl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119543466 |
| Molecular Formula | C16H25ClN4O5S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[3-[4-(methylaminomethyl)piperidin-1-yl]-3-oxopropyl]-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNCC1CCN(C(=O)CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1.Cl |
| InChI | InChI=1S/C16H24N4O5S.ClH/c1-17-12-13-7-10-19(11-8-13)16(21)6-9-18-26(24,25)15-4-2-14(3-5-15)20(22)23;/h2-5,13,17-18H,6-12H2,1H3;1H |
| InChIKey | UAUREYCYNCDALB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|