C15H16N4O3 — CID 119547379
1-methyl-5-nitro-N-(1,2,3,4-tetrahydroquinolin-6-yl)pyrrole-2-carboxamide (PubChem CID 119547379) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroquinolin-6-yl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroquinolin-6-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119547379 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroquinolin-6-yl)pyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc3c(c2)CCCN3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O3/c1-18-13(6-7-14(18)19(21)22)15(20)17-11-4-5-12-10(9-11)3-2-8-16-12/h4-7,9,16H,2-3,8H2,1H3,(H,17,20) |
| InChIKey | RSLBWUTUZXRGOF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|