C15H17ClN4O3 — CID 119581212
1-methyl-5-nitro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrole-2-carboxamide;hydrochloride (PubChem CID 119581212) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119581212 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-methyl-5-nitro-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1c(C(=O)Nc2ccc3c(c2)CNCC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O3.ClH/c1-18-13(4-5-14(18)19(21)22)15(20)17-12-3-2-10-6-7-16-9-11(10)8-12;/h2-5,8,16H,6-7,9H2,1H3,(H,17,20);1H |
| InChIKey | ZNXHJDNOGCCQMQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|