C19H24Cl2N2O — CID 119547992
N-[2-(4-aminophenyl)ethyl]-3-(3-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride (PubChem CID 119547992) has the molecular formula C19H24Cl2N2O and a molecular weight of 367.32 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-(3-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-(3-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119547992 |
| Molecular Formula | C19H24Cl2N2O |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-(3-chlorophenyl)-2,2-dimethylpropanamide;hydrochloride |
| SMILES | CC(C)(Cc1cccc(Cl)c1)C(=O)NCCc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C19H23ClN2O.ClH/c1-19(2,13-15-4-3-5-16(20)12-15)18(23)22-11-10-14-6-8-17(21)9-7-14;/h3-9,12H,10-11,13,21H2,1-2H3,(H,22,23);1H |
| InChIKey | NTLWGTPONKKYFA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|