C16H27ClN2O — CID 119548327
N-[2-(4-aminophenyl)ethyl]-2,2,4-trimethylpentanamide;hydrochloride (PubChem CID 119548327) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2,2,4-trimethylpentanamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2,2,4-trimethylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119548327 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2,2,4-trimethylpentanamide;hydrochloride |
| SMILES | CC(C)CC(C)(C)C(=O)NCCc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-12(2)11-16(3,4)15(19)18-10-9-13-5-7-14(17)8-6-13;/h5-8,12H,9-11,17H2,1-4H3,(H,18,19);1H |
| InChIKey | KDFLEHIFJBDBRZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|