C20H25ClN2O2 — CID 119548045
N-[2-(4-aminophenyl)ethyl]-2-phenyloxane-3-carboxamide;hydrochloride (PubChem CID 119548045) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.88 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-phenyloxane-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-phenyloxane-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119548045 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-phenyloxane-3-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CCNC(=O)C2CCCOC2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O2.ClH/c21-17-10-8-15(9-11-17)12-13-22-20(23)18-7-4-14-24-19(18)16-5-2-1-3-6-16;/h1-3,5-6,8-11,18-19H,4,7,12-14,21H2,(H,22,23);1H |
| InChIKey | ZHUMPEZYOCLETB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|