C19H26N2O4 — CID 94661285
(2R,3R)-N-[(4-carbamoyloxan-4-yl)methyl]-2-phenyloxane-3-carboxamide (PubChem CID 94661285) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R,3R)-N-[(4-carbamoyloxan-4-yl)methyl]-2-phenyloxane-3-carboxamide.
| Compound Name | (2R,3R)-N-[(4-carbamoyloxan-4-yl)methyl]-2-phenyloxane-3-carboxamide |
|---|---|
| PubChem CID | 94661285 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2R,3R)-N-[(4-carbamoyloxan-4-yl)methyl]-2-phenyloxane-3-carboxamide |
| SMILES | NC(=O)C1(CNC(=O)[C@@H]2CCCO[C@H]2c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C19H26N2O4/c20-18(23)19(8-11-24-12-9-19)13-21-17(22)15-7-4-10-25-16(15)14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2,(H2,20,23)(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | SSDQHCATMKBRNI-CVEARBPZSA-N |
| XLogP | 1.55 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |