C17H25Cl2N5O2 — CID 119549384
N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide;dihydrochloride (PubChem CID 119549384) has the molecular formula C17H25Cl2N5O2 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide;dihydrochloride.
| Compound Name | N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119549384 |
| Molecular Formula | C17H25Cl2N5O2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[2-[2-(4-aminophenyl)ethylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide;dihydrochloride |
| SMILES | CC(C(=O)N(C)CC(=O)NCCc1ccc(N)cc1)n1cccn1.Cl.Cl |
| InChI | InChI=1S/C17H23N5O2.2ClH/c1-13(22-11-3-9-20-22)17(24)21(2)12-16(23)19-10-8-14-4-6-15(18)7-5-14;;/h3-7,9,11,13H,8,10,12,18H2,1-2H3,(H,19,23);2*1H |
| InChIKey | YIHZKBLXACKUAO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|