C15H27N5O2 — CID 119571531
N-[2-[3-(aminomethyl)pentan-3-ylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide (PubChem CID 119571531) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[2-[3-(aminomethyl)pentan-3-ylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide.
| Compound Name | N-[2-[3-(aminomethyl)pentan-3-ylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 119571531 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N-[2-[3-(aminomethyl)pentan-3-ylamino]-2-oxoethyl]-N-methyl-2-pyrazol-1-ylpropanamide |
| SMILES | CCC(CC)(CN)NC(=O)CN(C)C(=O)C(C)n1cccn1 |
| InChI | InChI=1S/C15H27N5O2/c1-5-15(6-2,11-16)18-13(21)10-19(4)14(22)12(3)20-9-7-8-17-20/h7-9,12H,5-6,10-11,16H2,1-4H3,(H,18,21) |
| InChIKey | QAYHOUWESMNWNO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |