C15H18ClN3O3 — CID 119552387
N,2-dimethyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride (PubChem CID 119552387) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is N,2-dimethyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride.
| Compound Name | N,2-dimethyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119552387 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N,2-dimethyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide;hydrochloride |
| SMILES | CN1C(=O)c2ccc(C(=O)N(C)C3CCNC3)cc2C1=O.Cl |
| InChI | InChI=1S/C15H17N3O3.ClH/c1-17(10-5-6-16-8-10)13(19)9-3-4-11-12(7-9)15(21)18(2)14(11)20;/h3-4,7,10,16H,5-6,8H2,1-2H3;1H |
| InChIKey | NLPWEHLEBAMGEX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|