C18H23N3O3 — CID 119553699
2-butyl-N-methyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide (PubChem CID 119553699) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-butyl-N-methyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-methyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 119553699 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-butyl-N-methyl-1,3-dioxo-N-pyrrolidin-3-ylisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N(C)C3CCNC3)cc2C1=O |
| InChI | InChI=1S/C18H23N3O3/c1-3-4-9-21-17(23)14-6-5-12(10-15(14)18(21)24)16(22)20(2)13-7-8-19-11-13/h5-6,10,13,19H,3-4,7-9,11H2,1-2H3 |
| InChIKey | GHQRGXZCPRHANG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|