C18H22N2O5 — CID 119197950
2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)-propan-2-ylamino]acetic acid (PubChem CID 119197950) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)-propan-2-ylamino]acetic acid.
| Compound Name | 2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 119197950 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[(2-butyl-1,3-dioxoisoindole-5-carbonyl)-propan-2-ylamino]acetic acid |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N(CC(=O)O)C(C)C)cc2C1=O |
| InChI | InChI=1S/C18H22N2O5/c1-4-5-8-19-17(24)13-7-6-12(9-14(13)18(19)25)16(23)20(11(2)3)10-15(21)22/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,21,22) |
| InChIKey | NFXDJTMVKJARTA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|