C22H22N2O5 — CID 120581186
2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]-propan-2-ylamino]acetic acid (PubChem CID 120581186) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]-propan-2-ylamino]acetic acid.
| Compound Name | 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 120581186 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]-propan-2-ylamino]acetic acid |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N(CC(=O)O)C(C)C)cc3C2=O)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-12(2)23(11-19(25)26)20(27)15-7-8-16-17(10-15)22(29)24(21(16)28)18-9-13(3)5-6-14(18)4/h5-10,12H,11H2,1-4H3,(H,25,26) |
| InChIKey | PDVHRBVVYAXEBC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|