C18H26ClN3O2 — CID 119552795
1-(3,5-dimethylphenyl)-N-methyl-2-oxo-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119552795) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-methyl-2-oxo-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(3,5-dimethylphenyl)-N-methyl-2-oxo-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119552795 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-methyl-2-oxo-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)cc(N2CCC(C(=O)N(C)C3CCNC3)C2=O)c1.Cl |
| InChI | InChI=1S/C18H25N3O2.ClH/c1-12-8-13(2)10-15(9-12)21-7-5-16(18(21)23)17(22)20(3)14-4-6-19-11-14;/h8-10,14,16,19H,4-7,11H2,1-3H3;1H |
| InChIKey | AFNUJHVEXSIWHN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|