C18H26ClFN2O2 — CID 119556045
4-(3-fluorophenyl)-3-methyl-4-oxo-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride (PubChem CID 119556045) has the molecular formula C18H26ClFN2O2 and a molecular weight of 356.87 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-3-methyl-4-oxo-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride.
| Compound Name | 4-(3-fluorophenyl)-3-methyl-4-oxo-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119556045 |
| Molecular Formula | C18H26ClFN2O2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(3-fluorophenyl)-3-methyl-4-oxo-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCC1CCCNC1)C(=O)c1cccc(F)c1.Cl |
| InChI | InChI=1S/C18H25FN2O2.ClH/c1-13(18(23)15-5-2-6-16(19)11-15)10-17(22)21-9-7-14-4-3-8-20-12-14;/h2,5-6,11,13-14,20H,3-4,7-10,12H2,1H3,(H,21,22);1H |
| InChIKey | IRCBSHPUZQXOJZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |