C17H26ClFN2O — CID 119556662
3-(3-fluorophenyl)-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride (PubChem CID 119556662) has the molecular formula C17H26ClFN2O and a molecular weight of 328.86 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride.
| Compound Name | 3-(3-fluorophenyl)-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119556662 |
| Molecular Formula | C17H26ClFN2O |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(2-piperidin-3-ylethyl)butanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCC1CCCNC1)c1cccc(F)c1.Cl |
| InChI | InChI=1S/C17H25FN2O.ClH/c1-13(15-5-2-6-16(18)11-15)10-17(21)20-9-7-14-4-3-8-19-12-14;/h2,5-6,11,13-14,19H,3-4,7-10,12H2,1H3,(H,20,21);1H |
| InChIKey | PHEZDAUQEXUNPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |