C17H23F3N2O — CID 119557143
4,4,4-trifluoro-3-phenyl-N-(2-piperidin-3-ylethyl)butanamide (PubChem CID 119557143) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-phenyl-N-(2-piperidin-3-ylethyl)butanamide.
| Compound Name | 4,4,4-trifluoro-3-phenyl-N-(2-piperidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119557143 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4,4,4-trifluoro-3-phenyl-N-(2-piperidin-3-ylethyl)butanamide |
| SMILES | O=C(CC(c1ccccc1)C(F)(F)F)NCCC1CCCNC1 |
| InChI | InChI=1S/C17H23F3N2O/c18-17(19,20)15(14-6-2-1-3-7-14)11-16(23)22-10-8-13-5-4-9-21-12-13/h1-3,6-7,13,15,21H,4-5,8-12H2,(H,22,23) |
| InChIKey | OAQGZHVHJQPNEL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |