C19H29N3O3S — CID 119556818
2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-N-(2-piperidin-3-ylethyl)benzamide (PubChem CID 119556818) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-N-(2-piperidin-3-ylethyl)benzamide.
| Compound Name | 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-N-(2-piperidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 119556818 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-N-(2-piperidin-3-ylethyl)benzamide |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)NCCC1CCCNC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-25-12-11-21-18(23)14-26-17-7-3-2-6-16(17)19(24)22-10-8-15-5-4-9-20-13-15/h2-3,6-7,15,20H,4-5,8-14H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | TVRIEWFTRIVLHF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|