C18H24N2O2 — CID 119557256
2-(1-benzofuran-2-yl)-N-(2-piperidin-3-ylethyl)propanamide (PubChem CID 119557256) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-N-(2-piperidin-3-ylethyl)propanamide.
| Compound Name | 2-(1-benzofuran-2-yl)-N-(2-piperidin-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 119557256 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-N-(2-piperidin-3-ylethyl)propanamide |
| SMILES | CC(C(=O)NCCC1CCCNC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H24N2O2/c1-13(17-11-15-6-2-3-7-16(15)22-17)18(21)20-10-8-14-5-4-9-19-12-14/h2-3,6-7,11,13-14,19H,4-5,8-10,12H2,1H3,(H,20,21) |
| InChIKey | MRVPWRKGJFFAEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |