C18H27ClN2O3 — CID 119558587
3-methoxy-N-(2-piperidin-3-ylethyl)-4-prop-2-enoxybenzamide;hydrochloride (PubChem CID 119558587) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 3-methoxy-N-(2-piperidin-3-ylethyl)-4-prop-2-enoxybenzamide;hydrochloride.
| Compound Name | 3-methoxy-N-(2-piperidin-3-ylethyl)-4-prop-2-enoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119558587 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-methoxy-N-(2-piperidin-3-ylethyl)-4-prop-2-enoxybenzamide;hydrochloride |
| SMILES | C=CCOc1ccc(C(=O)NCCC2CCCNC2)cc1OC.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-3-11-23-16-7-6-15(12-17(16)22-2)18(21)20-10-8-14-5-4-9-19-13-14;/h3,6-7,12,14,19H,1,4-5,8-11,13H2,2H3,(H,20,21);1H |
| InChIKey | UKUOAQVTUGIDIY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|