C16H19BrN4O2 — CID 119561032
6-bromo-3-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 119561032) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is 6-bromo-3-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 119561032 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 6-bromo-3-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | CNC1CCN(C(=O)Cn2cnc3ccc(Br)cc3c2=O)CC1 |
| InChI | InChI=1S/C16H19BrN4O2/c1-18-12-4-6-20(7-5-12)15(22)9-21-10-19-14-3-2-11(17)8-13(14)16(21)23/h2-3,8,10,12,18H,4-7,9H2,1H3 |
| InChIKey | JHHFJIUNHZBISC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |