C15H17BrN4O2 — CID 119378564
3-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-6-bromoquinazolin-4-one (PubChem CID 119378564) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is 3-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-6-bromoquinazolin-4-one.
| Compound Name | 3-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-6-bromoquinazolin-4-one |
|---|---|
| PubChem CID | 119378564 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 3-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-6-bromoquinazolin-4-one |
| SMILES | NC1CCCN(C(=O)Cn2cnc3ccc(Br)cc3c2=O)C1 |
| InChI | InChI=1S/C15H17BrN4O2/c16-10-3-4-13-12(6-10)15(22)20(9-18-13)8-14(21)19-5-1-2-11(17)7-19/h3-4,6,9,11H,1-2,5,7-8,17H2 |
| InChIKey | PVPRADIYZSKSHT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |