C16H18N4O4 — CID 7227422
3-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-6-nitroquinazolin-4-one (PubChem CID 7227422) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-6-nitroquinazolin-4-one.
| Compound Name | 3-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 7227422 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]-6-nitroquinazolin-4-one |
| SMILES | C[C@H]1CCCN(C(=O)Cn2cnc3ccc([N+](=O)[O-])cc3c2=O)C1 |
| InChI | InChI=1S/C16H18N4O4/c1-11-3-2-6-18(8-11)15(21)9-19-10-17-14-5-4-12(20(23)24)7-13(14)16(19)22/h4-5,7,10-11H,2-3,6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | OOQJECAPCGYEEO-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|