C25H29N3O3 — CID 11956574
N,N,3-trimethyl-6-nitro-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine (PubChem CID 11956574) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N,N,3-trimethyl-6-nitro-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine.
| Compound Name | N,N,3-trimethyl-6-nitro-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
|---|---|
| PubChem CID | 11956574 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N,N,3-trimethyl-6-nitro-1'-phenylspiro[4,9-dihydro-3H-pyrano[3,4-b]indole-1,4'-cyclohexane]-1'-amine |
| SMILES | CC1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)C2(CCC(c3ccccc3)(N(C)C)CC2)O1 |
| InChI | InChI=1S/C25H29N3O3/c1-17-15-21-20-16-19(28(29)30)9-10-22(20)26-23(21)25(31-17)13-11-24(12-14-25,27(2)3)18-7-5-4-6-8-18/h4-10,16-17,26H,11-15H2,1-3H3 |
| InChIKey | AULHNJBHSOXPMG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|