C15H22BrFN2O2 — CID 119570150
N-[3-(aminomethyl)pentan-3-yl]-2-(2-bromo-4-fluorophenoxy)propanamide (PubChem CID 119570150) has the molecular formula C15H22BrFN2O2 and a molecular weight of 361.26 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-(2-bromo-4-fluorophenoxy)propanamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2-bromo-4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 119570150 |
| Molecular Formula | C15H22BrFN2O2 |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-(2-bromo-4-fluorophenoxy)propanamide |
| SMILES | CCC(CC)(CN)NC(=O)C(C)Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H22BrFN2O2/c1-4-15(5-2,9-18)19-14(20)10(3)21-13-7-6-11(17)8-12(13)16/h6-8,10H,4-5,9,18H2,1-3H3,(H,19,20) |
| InChIKey | UQMLPCIUSPSYOJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |