C16H24BrFN2O2 — CID 47040437
2-(2-bromo-4-fluorophenoxy)-N-[2-(diethylamino)propyl]propanamide (PubChem CID 47040437) has the molecular formula C16H24BrFN2O2 and a molecular weight of 375.28 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[2-(diethylamino)propyl]propanamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(diethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 47040437 |
| Molecular Formula | C16H24BrFN2O2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[2-(diethylamino)propyl]propanamide |
| SMILES | CCN(CC)C(C)CNC(=O)C(C)Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C16H24BrFN2O2/c1-5-20(6-2)11(3)10-19-16(21)12(4)22-15-8-7-13(18)9-14(15)17/h7-9,11-12H,5-6,10H2,1-4H3,(H,19,21) |
| InChIKey | OSIQLHUNLZDEGR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |