C19H21BrFNO3 — CID 42960788
2-(2-bromo-4-fluorophenoxy)-N-[[4-(ethoxymethyl)phenyl]methyl]propanamide (PubChem CID 42960788) has the molecular formula C19H21BrFNO3 and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[[4-(ethoxymethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[[4-(ethoxymethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 42960788 |
| Molecular Formula | C19H21BrFNO3 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[[4-(ethoxymethyl)phenyl]methyl]propanamide |
| SMILES | CCOCc1ccc(CNC(=O)C(C)Oc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C19H21BrFNO3/c1-3-24-12-15-6-4-14(5-7-15)11-22-19(23)13(2)25-18-9-8-16(21)10-17(18)20/h4-10,13H,3,11-12H2,1-2H3,(H,22,23) |
| InChIKey | CSUXHDYXYPIUKJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |