C16H23Cl3N2O2 — CID 119574926
N-(1-amino-2-cyclopropylpropan-2-yl)-4-(2,3-dichlorophenoxy)butanamide;hydrochloride (PubChem CID 119574926) has the molecular formula C16H23Cl3N2O2 and a molecular weight of 381.73 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-4-(2,3-dichlorophenoxy)butanamide;hydrochloride.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-(2,3-dichlorophenoxy)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119574926 |
| Molecular Formula | C16H23Cl3N2O2 |
| Molecular Weight | 381.73 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-4-(2,3-dichlorophenoxy)butanamide;hydrochloride |
| SMILES | CC(CN)(NC(=O)CCCOc1cccc(Cl)c1Cl)C1CC1.Cl |
| InChI | InChI=1S/C16H22Cl2N2O2.ClH/c1-16(10-19,11-7-8-11)20-14(21)6-3-9-22-13-5-2-4-12(17)15(13)18;/h2,4-5,11H,3,6-10,19H2,1H3,(H,20,21);1H |
| InChIKey | SECCPGZIGJLCAI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|