C16H27ClN2OS — CID 119573045
N-(1-amino-2-cyclopropylpropan-2-yl)-6-thiophen-2-ylhexanamide;hydrochloride (PubChem CID 119573045) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-6-thiophen-2-ylhexanamide;hydrochloride.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-6-thiophen-2-ylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 119573045 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-6-thiophen-2-ylhexanamide;hydrochloride |
| SMILES | CC(CN)(NC(=O)CCCCCc1cccs1)C1CC1.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-16(12-17,13-9-10-13)18-15(19)8-4-2-3-6-14-7-5-11-20-14;/h5,7,11,13H,2-4,6,8-10,12,17H2,1H3,(H,18,19);1H |
| InChIKey | AJPPXSCWJDKSBY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|